C21H23NO3S2 — CID 16636709
ethyl 2-[(9S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate (PubChem CID 16636709) has the molecular formula C21H23NO3S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is ethyl 2-[(9S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate.
| Compound Name | ethyl 2-[(9S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate |
|---|---|
| PubChem CID | 16636709 |
| Molecular Formula | C21H23NO3S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | ethyl 2-[(9S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)C(c1ccccc1)C1C3CCC(C3)C1S2 |
| InChI | InChI=1S/C21H23NO3S2/c1-2-25-15(23)11-22-20-19(27-21(22)24)16(12-6-4-3-5-7-12)17-13-8-9-14(10-13)18(17)26-20/h3-7,13-14,16-18H,2,8-11H2,1H3 |
| InChIKey | ZZLAOMFJSHLKSH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|