C23H28N2O3S2 — CID 43849175
ethyl 2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate (PubChem CID 43849175) has the molecular formula C23H28N2O3S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is ethyl 2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate.
| Compound Name | ethyl 2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate |
|---|---|
| PubChem CID | 43849175 |
| Molecular Formula | C23H28N2O3S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1ccc(N(C)C)cc1)C1C3CCC(C3)C1S2 |
| InChI | InChI=1S/C23H28N2O3S2/c1-4-28-17(26)12-25-22-21(30-23(25)27)18(13-7-9-16(10-8-13)24(2)3)19-14-5-6-15(11-14)20(19)29-22/h7-10,14-15,18-20H,4-6,11-12H2,1-3H3/t14?,15?,18-,19?,20?/m0/s1 |
| InChIKey | MPDMZIJVLPVSCV-GWUCBVIASA-N |
| XLogP | 4.19 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|