C30H33N3O4S2 — CID 43849040
ethyl 4-[[2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]benzoate (PubChem CID 43849040) has the molecular formula C30H33N3O4S2 and a molecular weight of 563.75 g/mol. Its IUPAC name is ethyl 4-[[2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43849040 |
| Molecular Formula | C30H33N3O4S2 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | ethyl 4-[[2-[(9R)-9-[4-(dimethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(N(C)C)cc2)C2C4CCC(C4)C2S3)cc1 |
| InChI | InChI=1S/C30H33N3O4S2/c1-4-37-29(35)18-7-11-21(12-8-18)31-23(34)16-33-28-27(39-30(33)36)24(17-9-13-22(14-10-17)32(2)3)25-19-5-6-20(15-19)26(25)38-28/h7-14,19-20,24-26H,4-6,15-16H2,1-3H3,(H,31,34)/t19?,20?,24-,25?,26?/m0/s1 |
| InChIKey | LFEUMGOVPGXACI-XIHAIFIBSA-N |
| XLogP | 5.44 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|