C29H33N3O3S2 — CID 19250087
2-[(1S,2R,9R,10S,11S)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 19250087) has the molecular formula C29H33N3O3S2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 2-[(1S,2R,9R,10S,11S)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(1S,2R,9R,10S,11S)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19250087 |
| Molecular Formula | C29H33N3O3S2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-[(1S,2R,9R,10S,11S)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCN(CC)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(O)cc4)c3S[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]23)cc1 |
| InChI | InChI=1S/C29H33N3O3S2/c1-3-31(4-2)21-11-7-17(8-12-21)24-25-18-5-6-19(15-18)26(25)36-28-27(24)37-29(35)32(28)16-23(34)30-20-9-13-22(33)14-10-20/h7-14,18-19,24-26,33H,3-6,15-16H2,1-2H3,(H,30,34)/t18-,19-,24-,25-,26+/m0/s1 |
| InChIKey | XEANIUBCTGKQSM-HFHBXGEPSA-N |
| XLogP | 5.75 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|