C27H28N2O5S2 — CID 16636668
2-[(9S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16636668) has the molecular formula C27H28N2O5S2 and a molecular weight of 524.66 g/mol. Its IUPAC name is 2-[(9S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(9S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16636668 |
| Molecular Formula | C27H28N2O5S2 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[(9S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(O)cc4)c3SC3C4CCC(C4)C23)cc1OC |
| InChI | InChI=1S/C27H28N2O5S2/c1-33-19-10-5-15(12-20(19)34-2)23-22-14-3-4-16(11-14)24(22)35-26-25(23)36-27(32)29(26)13-21(31)28-17-6-8-18(30)9-7-17/h5-10,12,14,16,22-24,30H,3-4,11,13H2,1-2H3,(H,28,31) |
| InChIKey | JOEPGBDZQIOXMU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|