C28H30N2O5S2 — CID 19250044
2-[(1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 19250044) has the molecular formula C28H30N2O5S2 and a molecular weight of 538.69 g/mol. Its IUPAC name is 2-[(1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19250044 |
| Molecular Formula | C28H30N2O5S2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-[(1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(OC)c(OC)c2)[C@@H]2[C@H]4CC[C@@H](C4)[C@H]2S3)cc1 |
| InChI | InChI=1S/C28H30N2O5S2/c1-33-19-9-7-18(8-10-19)29-22(31)14-30-27-26(37-28(30)32)24(16-6-11-20(34-2)21(13-16)35-3)23-15-4-5-17(12-15)25(23)36-27/h6-11,13,15,17,23-25H,4-5,12,14H2,1-3H3,(H,29,31)/t15-,17-,23-,24-,25+/m0/s1 |
| InChIKey | BAAUOSHQSCXXSU-MENBTHMGSA-N |
| XLogP | 5.23 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|