C26H32N2O4S2 — CID 19250014
(1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 19250014) has the molecular formula C26H32N2O4S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is (1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 19250014 |
| Molecular Formula | C26H32N2O4S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (1S,2R,9R,10S,11S)-9-(3,4-dimethoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3S[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]23)cc1OC |
| InChI | InChI=1S/C26H32N2O4S2/c1-31-18-9-8-16(13-19(18)32-2)22-21-15-6-7-17(12-15)23(21)33-25-24(22)34-26(30)28(25)14-20(29)27-10-4-3-5-11-27/h8-9,13,15,17,21-23H,3-7,10-12,14H2,1-2H3/t15-,17-,21-,22-,23+/m0/s1 |
| InChIKey | DPDYHZKUCSGAOR-CAYGFMCYSA-N |
| XLogP | 4.59 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|