C29H33N3O2S2 — CID 43848966
2-[(9R)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-phenylacetamide (PubChem CID 43848966) has the molecular formula C29H33N3O2S2 and a molecular weight of 519.74 g/mol. Its IUPAC name is 2-[(9R)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(9R)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 43848966 |
| Molecular Formula | C29H33N3O2S2 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-[(9R)-9-[4-(diethylamino)phenyl]-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-phenylacetamide |
| SMILES | CCN(CC)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccccc4)c3SC3C4CCC(C4)C32)cc1 |
| InChI | InChI=1S/C29H33N3O2S2/c1-3-31(4-2)22-14-12-18(13-15-22)24-25-19-10-11-20(16-19)26(25)35-28-27(24)36-29(34)32(28)17-23(33)30-21-8-6-5-7-9-21/h5-9,12-15,19-20,24-26H,3-4,10-11,16-17H2,1-2H3,(H,30,33)/t19?,20?,24-,25?,26?/m0/s1 |
| InChIKey | HBZMLICDBUVMQG-XIHAIFIBSA-N |
| XLogP | 6.05 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|