C27H27N5O7S3 — CID 43846548
(8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 43846548) has the molecular formula C27H27N5O7S3 and a molecular weight of 629.74 g/mol. Its IUPAC name is (8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 43846548 |
| Molecular Formula | C27H27N5O7S3 |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | (8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)N(C(N)=O)C(=O)C32)cc1 |
| InChI | InChI=1S/C27H27N5O7S3/c1-27(2,3)14-6-4-13(5-7-14)18-19-20(23(35)32(22(19)34)25(28)36)40-24-21(18)41-26(37)31(24)12-17(33)30-15-8-10-16(11-9-15)42(29,38)39/h4-11,18-20H,12H2,1-3H3,(H2,28,36)(H,30,33)(H2,29,38,39)/t18-,19?,20?/m0/s1 |
| InChIKey | IDCKPRDSENSKGA-HDYDNRTBSA-N |
| XLogP | 2.16 |
| TPSA | 191.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|