C22H18N4O7S3 — CID 21227180
2-[8-(4-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 21227180) has the molecular formula C22H18N4O7S3 and a molecular weight of 546.61 g/mol. Its IUPAC name is 2-[8-(4-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[8-(4-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 21227180 |
| Molecular Formula | C22H18N4O7S3 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | 2-[8-(4-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(O)cc2)C2C(=O)NC(=O)C2S3)cc1 |
| InChI | InChI=1S/C22H18N4O7S3/c23-36(32,33)13-7-3-11(4-8-13)24-14(28)9-26-21-18(35-22(26)31)15(10-1-5-12(27)6-2-10)16-17(34-21)20(30)25-19(16)29/h1-8,15-17,27H,9H2,(H,24,28)(H2,23,32,33)(H,25,29,30) |
| InChIKey | GOCPGFQUFMQCOI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 177.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|