C23H18FN3O6S2 — CID 21227145
N-(4-fluorophenyl)-2-[8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 21227145) has the molecular formula C23H18FN3O6S2 and a molecular weight of 515.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 21227145 |
| Molecular Formula | C23H18FN3O6S2 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | N-(4-fluorophenyl)-2-[8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | COc1cc(C2c3sc(=O)n(CC(=O)Nc4ccc(F)cc4)c3SC3C(=O)NC(=O)C32)ccc1O |
| InChI | InChI=1S/C23H18FN3O6S2/c1-33-14-8-10(2-7-13(14)28)16-17-18(21(31)26-20(17)30)34-22-19(16)35-23(32)27(22)9-15(29)25-12-5-3-11(24)4-6-12/h2-8,16-18,28H,9H2,1H3,(H,25,29)(H,26,30,31) |
| InChIKey | ADDSDPXJFKRTLH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|