C24H20ClN3O6S2 — CID 21227124
N-(4-chlorophenyl)-2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 21227124) has the molecular formula C24H20ClN3O6S2 and a molecular weight of 546.03 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 21227124 |
| Molecular Formula | C24H20ClN3O6S2 |
| Molecular Weight | 546.03 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(Cl)cc4)c3SC3C(=O)NC(=O)C32)cc1OC |
| InChI | InChI=1S/C24H20ClN3O6S2/c1-33-14-8-3-11(9-15(14)34-2)17-18-19(22(31)27-21(18)30)35-23-20(17)36-24(32)28(23)10-16(29)26-13-6-4-12(25)5-7-13/h3-9,17-19H,10H2,1-2H3,(H,26,29)(H,27,30,31) |
| InChIKey | XLDVVNYNFPPFGS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.03 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|