C22H16ClN3O4S2 — CID 43846598
2-[(8R)-8-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 43846598) has the molecular formula C22H16ClN3O4S2 and a molecular weight of 485.97 g/mol. Its IUPAC name is 2-[(8R)-8-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[(8R)-8-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 43846598 |
| Molecular Formula | C22H16ClN3O4S2 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 2-[(8R)-8-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccc(Cl)cc1)C1C(=O)NC(=O)C1S2)Nc1ccccc1 |
| InChI | InChI=1S/C22H16ClN3O4S2/c23-12-8-6-11(7-9-12)15-16-17(20(29)25-19(16)28)31-21-18(15)32-22(30)26(21)10-14(27)24-13-4-2-1-3-5-13/h1-9,15-17H,10H2,(H,24,27)(H,25,28,29)/t15-,16?,17?/m0/s1 |
| InChIKey | SDSFHNYJBLXXRS-GTPINHCMSA-N |
| XLogP | 3.08 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|