C25H21N3O6S2 — CID 18862928
ethyl 4-[[2-[(1S,8R,9S)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862928) has the molecular formula C25H21N3O6S2 and a molecular weight of 523.59 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862928 |
| Molecular Formula | C25H21N3O6S2 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2)[C@H]2C(=O)NC(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C25H21N3O6S2/c1-2-34-24(32)14-8-10-15(11-9-14)26-16(29)12-28-23-20(36-25(28)33)17(13-6-4-3-5-7-13)18-19(35-23)22(31)27-21(18)30/h3-11,17-19H,2,12H2,1H3,(H,26,29)(H,27,30,31)/t17-,18+,19-/m0/s1 |
| InChIKey | AIJRTJXCZVPUGM-OTWHNJEPSA-N |
| XLogP | 2.60 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|