C22H17N3O5S2 — CID 21227121
2-[8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 21227121) has the molecular formula C22H17N3O5S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-[8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 21227121 |
| Molecular Formula | C22H17N3O5S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-[8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccccc1O)C1C(=O)NC(=O)C1S2)Nc1ccccc1 |
| InChI | InChI=1S/C22H17N3O5S2/c26-13-9-5-4-8-12(13)15-16-17(20(29)24-19(16)28)31-21-18(15)32-22(30)25(21)10-14(27)23-11-6-2-1-3-7-11/h1-9,15-17,26H,10H2,(H,23,27)(H,24,28,29) |
| InChIKey | ZBNMKBWXGUXMAB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|