C20H14ClN3O4S3 — CID 43846612
N-(4-chlorophenyl)-2-[(8R)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 43846612) has the molecular formula C20H14ClN3O4S3 and a molecular weight of 492.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(8R)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(8R)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 43846612 |
| Molecular Formula | C20H14ClN3O4S3 |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 490.98 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(8R)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccs1)C1C(=O)NC(=O)C1S2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClN3O4S3/c21-9-3-5-10(6-4-9)22-12(25)8-24-19-16(31-20(24)28)13(11-2-1-7-29-11)14-15(30-19)18(27)23-17(14)26/h1-7,13-15H,8H2,(H,22,25)(H,23,26,27)/t13-,14?,15?/m0/s1 |
| InChIKey | UIKVCMMMUOTHNO-NFOMZHRRSA-N |
| XLogP | 3.14 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|