C23H19N3O6S2 — CID 43846709
2-[(8R)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 43846709) has the molecular formula C23H19N3O6S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[(8R)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43846709 |
| Molecular Formula | C23H19N3O6S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-[(8R)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2O)C2C(=O)NC(=O)C2S3)cc1 |
| InChI | InChI=1S/C23H19N3O6S2/c1-32-12-8-6-11(7-9-12)24-15(28)10-26-22-19(34-23(26)31)16(13-4-2-3-5-14(13)27)17-18(33-22)21(30)25-20(17)29/h2-9,16-18,27H,10H2,1H3,(H,24,28)(H,25,29,30)/t16-,17?,18?/m0/s1 |
| InChIKey | FWYMNXJEOGSBFA-AOCRQIFASA-N |
| XLogP | 2.14 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|