C23H20N4O7S3 — CID 43846666
2-[(8R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43846666) has the molecular formula C23H20N4O7S3 and a molecular weight of 560.64 g/mol. Its IUPAC name is 2-[(8R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43846666 |
| Molecular Formula | C23H20N4O7S3 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 2-[(8R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)NC(=O)C32)cc1 |
| InChI | InChI=1S/C23H20N4O7S3/c1-34-13-6-2-11(3-7-13)16-17-18(21(30)26-20(17)29)35-22-19(16)36-23(31)27(22)10-15(28)25-12-4-8-14(9-5-12)37(24,32)33/h2-9,16-18H,10H2,1H3,(H,25,28)(H2,24,32,33)(H,26,29,30)/t16-,17?,18?/m0/s1 |
| InChIKey | WVWWAOGOOHAKLU-AOCRQIFASA-N |
| XLogP | 1.08 |
| TPSA | 166.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|