C28H23N5O7S3 — CID 43847966
2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43847966) has the molecular formula C28H23N5O7S3 and a molecular weight of 637.72 g/mol. Its IUPAC name is 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43847966 |
| Molecular Formula | C28H23N5O7S3 |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.08 |
| IUPAC Name | 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(S(N)(=O)=O)cc4)C(c4cccnc4)C3C2=O)cc1 |
| InChI | InChI=1S/C28H23N5O7S3/c1-40-18-8-6-17(7-9-18)33-25(35)22-21(15-3-2-12-30-13-15)24-27(41-23(22)26(33)36)32(28(37)42-24)14-20(34)31-16-4-10-19(11-5-16)43(29,38)39/h2-13,21-23H,14H2,1H3,(H,31,34)(H2,29,38,39) |
| InChIKey | OJCAJXDEUHSHHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 170.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|