C24H21N3O6S2 — CID 19249042
ethyl 2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 19249042) has the molecular formula C24H21N3O6S2 and a molecular weight of 511.58 g/mol. Its IUPAC name is ethyl 2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 19249042 |
| Molecular Formula | C24H21N3O6S2 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | ethyl 2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1cccnc1)[C@@H]1C(=O)N(c3ccc(OC)cc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C24H21N3O6S2/c1-3-33-16(28)12-26-23-20(35-24(26)31)17(13-5-4-10-25-11-13)18-19(34-23)22(30)27(21(18)29)14-6-8-15(32-2)9-7-14/h4-11,17-19H,3,12H2,1-2H3/t17-,18-,19+/m0/s1 |
| InChIKey | CDFWIJVZKVEXFN-GBESFXJTSA-N |
| XLogP | 2.67 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|