C22H18N6O7S3 — CID 21227069
5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 21227069) has the molecular formula C22H18N6O7S3 and a molecular weight of 574.62 g/mol. Its IUPAC name is 5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | 5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 21227069 |
| Molecular Formula | C22H18N6O7S3 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | NC(=O)N1C(=O)C2Sc3c(sc(=O)n3CC(=O)Nc3ccc(S(N)(=O)=O)cc3)C(c3cccnc3)C2C1=O |
| InChI | InChI=1S/C22H18N6O7S3/c23-21(32)28-18(30)15-14(10-2-1-7-25-8-10)17-20(36-16(15)19(28)31)27(22(33)37-17)9-13(29)26-11-3-5-12(6-4-11)38(24,34)35/h1-8,14-16H,9H2,(H2,23,32)(H,26,29)(H2,24,34,35) |
| InChIKey | TZXXLMIOXVZDHG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 204.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|