C25H23N3O6S2 — CID 43846617
2-[(8R)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 43846617) has the molecular formula C25H23N3O6S2 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-[(8R)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43846617 |
| Molecular Formula | C25H23N3O6S2 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-[(8R)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(C)cc4)c3SC3C(=O)NC(=O)C32)cc1OC |
| InChI | InChI=1S/C25H23N3O6S2/c1-12-4-7-14(8-5-12)26-17(29)11-28-24-21(36-25(28)32)18(19-20(35-24)23(31)27-22(19)30)13-6-9-15(33-2)16(10-13)34-3/h4-10,18-20H,11H2,1-3H3,(H,26,29)(H,27,30,31)/t18-,19?,20?/m0/s1 |
| InChIKey | AIIBWYFSEIKZMD-HDYDNRTBSA-N |
| XLogP | 2.75 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|