C26H26N4O6S3 — CID 43846668
2-[(8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43846668) has the molecular formula C26H26N4O6S3 and a molecular weight of 586.72 g/mol. Its IUPAC name is 2-[(8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43846668 |
| Molecular Formula | C26H26N4O6S3 |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 2-[(8R)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)NC(=O)C32)cc1 |
| InChI | InChI=1S/C26H26N4O6S3/c1-26(2,3)14-6-4-13(5-7-14)18-19-20(23(33)29-22(19)32)37-24-21(18)38-25(34)30(24)12-17(31)28-15-8-10-16(11-9-15)39(27,35)36/h4-11,18-20H,12H2,1-3H3,(H,28,31)(H2,27,35,36)(H,29,32,33)/t18-,19?,20?/m0/s1 |
| InChIKey | CENCXRFXCSMJOD-HDYDNRTBSA-N |
| XLogP | 2.37 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|