C21H21N3O7S2 — CID 18862966
(1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 18862966) has the molecular formula C21H21N3O7S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is (1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 18862966 |
| Molecular Formula | C21H21N3O7S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | (1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1cc([C@@H]2c3sc(=O)n(CC(=O)N4CCOCC4)c3S[C@@H]3C(=O)NC(=O)[C@H]23)ccc1O |
| InChI | InChI=1S/C21H21N3O7S2/c1-30-12-8-10(2-3-11(12)25)14-15-16(19(28)22-18(15)27)32-20-17(14)33-21(29)24(20)9-13(26)23-4-6-31-7-5-23/h2-3,8,14-16,25H,4-7,9H2,1H3,(H,22,27,28)/t14-,15+,16-/m0/s1 |
| InChIKey | ZGIYUYRWAGOSPV-XHSDSOJGSA-N |
| XLogP | 0.36 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|