C31H33N3O5S2 — CID 103596347
(8S)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 103596347) has the molecular formula C31H33N3O5S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is (8S)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 103596347 |
| Molecular Formula | C31H33N3O5S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | (8S)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCOCC4)[C@H](c4ccc(C(C)(C)C)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C31H33N3O5S2/c1-18-5-11-21(12-6-18)34-27(36)24-23(19-7-9-20(10-8-19)31(2,3)4)26-29(40-25(24)28(34)37)33(30(38)41-26)17-22(35)32-13-15-39-16-14-32/h5-12,23-25H,13-17H2,1-4H3/t23-,24?,25?/m1/s1 |
| InChIKey | HZHHIEKSPZATFQ-CZUALIRWSA-N |
| XLogP | 4.17 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|