C31H31N3O4S3 — CID 18859744
14-(4-methylphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 18859744) has the molecular formula C31H31N3O4S3 and a molecular weight of 605.81 g/mol. Its IUPAC name is 14-(4-methylphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | 14-(4-methylphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 18859744 |
| Molecular Formula | C31H31N3O4S3 |
| Molecular Weight | 605.81 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | 14-(4-methylphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cccs3)c3sc(=O)n(CC(=O)N5CCCCC5)c3SC42)cc1 |
| InChI | InChI=1S/C31H31N3O4S3/c1-16-7-9-17(10-8-16)34-28(36)23-18-14-19(24(23)29(34)37)26-22(18)25(20-6-5-13-39-20)27-30(40-26)33(31(38)41-27)15-21(35)32-11-3-2-4-12-32/h5-10,13,18-19,22-26H,2-4,11-12,14-15H2,1H3 |
| InChIKey | DVGDKIUDKOUBBM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|