C32H27N3O5S3 — CID 18859749
N-(4-hydroxyphenyl)-2-[14-(4-methylphenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide (PubChem CID 18859749) has the molecular formula C32H27N3O5S3 and a molecular weight of 629.79 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[14-(4-methylphenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[14-(4-methylphenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide |
|---|---|
| PubChem CID | 18859749 |
| Molecular Formula | C32H27N3O5S3 |
| Molecular Weight | 629.79 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[14-(4-methylphenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cccs3)c3sc(=O)n(CC(=O)Nc5ccc(O)cc5)c3SC42)cc1 |
| InChI | InChI=1S/C32H27N3O5S3/c1-15-4-8-17(9-5-15)35-29(38)24-19-13-20(25(24)30(35)39)27-23(19)26(21-3-2-12-41-21)28-31(42-27)34(32(40)43-28)14-22(37)33-16-6-10-18(36)11-7-16/h2-12,19-20,23-27,36H,13-14H2,1H3,(H,33,37) |
| InChIKey | HPZJWZHAHRMVCO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|