C32H24ClN3O6S3 — CID 18859711
4-[[2-[14-(4-chlorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoic acid (PubChem CID 18859711) has the molecular formula C32H24ClN3O6S3 and a molecular weight of 678.21 g/mol. Its IUPAC name is 4-[[2-[14-(4-chlorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[14-(4-chlorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18859711 |
| Molecular Formula | C32H24ClN3O6S3 |
| Molecular Weight | 678.21 g/mol |
| Exact Mass | 677.05 |
| IUPAC Name | 4-[[2-[14-(4-chlorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1cccs1)C1C3CC(C1S2)C1C(=O)N(c2ccc(Cl)cc2)C(=O)C31)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H24ClN3O6S3/c33-15-5-9-17(10-6-15)36-28(38)23-18-12-19(24(23)29(36)39)26-22(18)25(20-2-1-11-43-20)27-30(44-26)35(32(42)45-27)13-21(37)34-16-7-3-14(4-8-16)31(40)41/h1-11,18-19,22-26H,12-13H2,(H,34,37)(H,40,41) |
| InChIKey | PRKKHUHGDDMBCR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.21 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|