C32H26FN3O5S3 — CID 18859728
2-[14-(4-fluorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 18859728) has the molecular formula C32H26FN3O5S3 and a molecular weight of 647.78 g/mol. Its IUPAC name is 2-[14-(4-fluorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[14-(4-fluorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18859728 |
| Molecular Formula | C32H26FN3O5S3 |
| Molecular Weight | 647.78 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | 2-[14-(4-fluorophenyl)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)C(c2cccs2)C2C4CC(C2S3)C2C(=O)N(c3ccc(F)cc3)C(=O)C42)cc1 |
| InChI | InChI=1S/C32H26FN3O5S3/c1-41-18-10-6-16(7-11-18)34-22(37)14-35-31-28(44-32(35)40)26(21-3-2-12-42-21)23-19-13-20(27(23)43-31)25-24(19)29(38)36(30(25)39)17-8-4-15(33)5-9-17/h2-12,19-20,23-27H,13-14H2,1H3,(H,34,37) |
| InChIKey | SOLQNZBZPUGABP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.78 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|