C34H29N3O6S2 — CID 18859497
N-(4-hydroxyphenyl)-2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide (PubChem CID 18859497) has the molecular formula C34H29N3O6S2 and a molecular weight of 639.76 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide |
|---|---|
| PubChem CID | 18859497 |
| Molecular Formula | C34H29N3O6S2 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(O)cc4)c3SC3C4CC(C5C(=O)N(c6ccccc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C34H29N3O6S2/c1-43-21-13-7-17(8-14-21)25-26-22-15-23(28-27(22)31(40)37(32(28)41)19-5-3-2-4-6-19)29(26)44-33-30(25)45-34(42)36(33)16-24(39)35-18-9-11-20(38)12-10-18/h2-14,22-23,25-29,38H,15-16H2,1H3,(H,35,39) |
| InChIKey | RDVSRDADSPJEGZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|