C35H30ClN3O6S2 — CID 18859548
2-[14-(4-chlorophenyl)-9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 18859548) has the molecular formula C35H30ClN3O6S2 and a molecular weight of 688.23 g/mol. Its IUPAC name is 2-[14-(4-chlorophenyl)-9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[14-(4-chlorophenyl)-9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18859548 |
| Molecular Formula | C35H30ClN3O6S2 |
| Molecular Weight | 688.23 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | 2-[14-(4-chlorophenyl)-9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(OC)cc2)C2C4CC(C2S3)C2C(=O)N(c3ccc(Cl)cc3)C(=O)C42)cc1 |
| InChI | InChI=1S/C35H30ClN3O6S2/c1-44-21-11-3-17(4-12-21)26-27-23-15-24(29-28(23)32(41)39(33(29)42)20-9-5-18(36)6-10-20)30(27)46-34-31(26)47-35(43)38(34)16-25(40)37-19-7-13-22(45-2)14-8-19/h3-14,23-24,26-30H,15-16H2,1-2H3,(H,37,40) |
| InChIKey | RDDXWZQLJOOHFY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.23 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|