C37H32ClN3O6S2 — CID 18859652
ethyl 4-[[2-[9-(4-chlorophenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate (PubChem CID 18859652) has the molecular formula C37H32ClN3O6S2 and a molecular weight of 714.27 g/mol. Its IUPAC name is ethyl 4-[[2-[9-(4-chlorophenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[9-(4-chlorophenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18859652 |
| Molecular Formula | C37H32ClN3O6S2 |
| Molecular Weight | 714.27 g/mol |
| Exact Mass | 713.14 |
| IUPAC Name | ethyl 4-[[2-[9-(4-chlorophenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(Cl)cc2)C2C4CC(C2S3)C2C(=O)N(c3ccc(C)cc3)C(=O)C42)cc1 |
| InChI | InChI=1S/C37H32ClN3O6S2/c1-3-47-36(45)20-8-12-22(13-9-20)39-26(42)17-40-35-32(49-37(40)46)27(19-6-10-21(38)11-7-19)28-24-16-25(31(28)48-35)30-29(24)33(43)41(34(30)44)23-14-4-18(2)5-15-23/h4-15,24-25,27-31H,3,16-17H2,1-2H3,(H,39,42) |
| InChIKey | ANPXNHOMOOHZOH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.27 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|