C29H24ClFN2O5S2 — CID 18859644
ethyl 2-[9-(4-chlorophenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetate (PubChem CID 18859644) has the molecular formula C29H24ClFN2O5S2 and a molecular weight of 599.11 g/mol. Its IUPAC name is ethyl 2-[9-(4-chlorophenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetate.
| Compound Name | ethyl 2-[9-(4-chlorophenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetate |
|---|---|
| PubChem CID | 18859644 |
| Molecular Formula | C29H24ClFN2O5S2 |
| Molecular Weight | 599.11 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | ethyl 2-[9-(4-chlorophenyl)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)C(c1ccc(Cl)cc1)C1C3CC(C1S2)C1C(=O)N(c2ccc(F)cc2)C(=O)C31 |
| InChI | InChI=1S/C29H24ClFN2O5S2/c1-2-38-19(34)12-32-28-25(40-29(32)37)20(13-3-5-14(30)6-4-13)21-17-11-18(24(21)39-28)23-22(17)26(35)33(27(23)36)16-9-7-15(31)8-10-16/h3-10,17-18,20-24H,2,11-12H2,1H3 |
| InChIKey | XLGUYZRWKAUJMK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.11 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|