C32H24Cl2N2O3S2 — CID 124711825
(1R,2R,9R,10R,11S,12S,16S)-5-benzyl-9,14-bis(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 124711825) has the molecular formula C32H24Cl2N2O3S2 and a molecular weight of 619.60 g/mol. Its IUPAC name is (1R,2R,9R,10R,11S,12S,16S)-5-benzyl-9,14-bis(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2R,9R,10R,11S,12S,16S)-5-benzyl-9,14-bis(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 124711825 |
| Molecular Formula | C32H24Cl2N2O3S2 |
| Molecular Weight | 619.60 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | (1R,2R,9R,10R,11S,12S,16S)-5-benzyl-9,14-bis(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1ccc(Cl)cc1)[C@@H]1[C@H](c2ccc(Cl)cc2)c2sc(=O)n(Cc4ccccc4)c2S[C@H]31 |
| InChI | InChI=1S/C32H24Cl2N2O3S2/c33-18-8-6-17(7-9-18)23-24-21-14-22(26-25(21)29(37)36(30(26)38)20-12-10-19(34)11-13-20)27(24)40-31-28(23)41-32(39)35(31)15-16-4-2-1-3-5-16/h1-13,21-27H,14-15H2/t21-,22-,23+,24-,25+,26-,27-/m1/s1 |
| InChIKey | RDJBLQOEINHEDU-GNIBRYFQSA-N |
| XLogP | 6.94 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|