C27H17Cl2FN2O3S2 — CID 98144462
(1R,8R,9S)-8-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-11-(4-fluorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 98144462) has the molecular formula C27H17Cl2FN2O3S2 and a molecular weight of 571.48 g/mol. Its IUPAC name is (1R,8R,9S)-8-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-11-(4-fluorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9S)-8-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-11-(4-fluorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 98144462 |
| Molecular Formula | C27H17Cl2FN2O3S2 |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | (1R,8R,9S)-8-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-11-(4-fluorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1[C@@H]2[C@H](c3ccc(Cl)cc3)c3sc(=O)n(Cc4ccc(Cl)cc4)c3S[C@H]2C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H17Cl2FN2O3S2/c28-16-5-1-14(2-6-16)13-31-26-23(37-27(31)35)20(15-3-7-17(29)8-4-15)21-22(36-26)25(34)32(24(21)33)19-11-9-18(30)10-12-19/h1-12,20-22H,13H2/t20-,21+,22+/m0/s1 |
| InChIKey | KOIPFHQDNDZSTC-BHDDXSALSA-N |
| XLogP | 6.20 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|