C39H37N3O8S2 — CID 18859472
ethyl 4-[[2-[9-(3,4-dimethoxyphenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate (PubChem CID 18859472) has the molecular formula C39H37N3O8S2 and a molecular weight of 739.87 g/mol. Its IUPAC name is ethyl 4-[[2-[9-(3,4-dimethoxyphenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[9-(3,4-dimethoxyphenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18859472 |
| Molecular Formula | C39H37N3O8S2 |
| Molecular Weight | 739.87 g/mol |
| Exact Mass | 739.20 |
| IUPAC Name | ethyl 4-[[2-[9-(3,4-dimethoxyphenyl)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(OC)c(OC)c2)C2C4CC(C2S3)C2C(=O)N(c3ccc(C)cc3)C(=O)C42)cc1 |
| InChI | InChI=1S/C39H37N3O8S2/c1-5-50-38(46)20-8-11-22(12-9-20)40-28(43)18-41-37-34(52-39(41)47)29(21-10-15-26(48-3)27(16-21)49-4)30-24-17-25(33(30)51-37)32-31(24)35(44)42(36(32)45)23-13-6-19(2)7-14-23/h6-16,24-25,29-33H,5,17-18H2,1-4H3,(H,40,43) |
| InChIKey | GVKTWYLOGMQQET-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|