C35H30FN3O6S2 — CID 18859416
2-[9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 18859416) has the molecular formula C35H30FN3O6S2 and a molecular weight of 671.77 g/mol. Its IUPAC name is 2-[9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18859416 |
| Molecular Formula | C35H30FN3O6S2 |
| Molecular Weight | 671.77 g/mol |
| Exact Mass | 671.16 |
| IUPAC Name | 2-[9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(F)cc4)c3SC3C4CC(C5C(=O)N(c6ccccc6)C(=O)C45)C23)cc1OC |
| InChI | InChI=1S/C35H30FN3O6S2/c1-44-23-13-8-17(14-24(23)45-2)26-27-21-15-22(29-28(21)32(41)39(33(29)42)20-6-4-3-5-7-20)30(27)46-34-31(26)47-35(43)38(34)16-25(40)37-19-11-9-18(36)10-12-19/h3-14,21-22,26-30H,15-16H2,1-2H3,(H,37,40) |
| InChIKey | NNTOKYNAHVXXIB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|