C35H28F3N3O5S2 — CID 18859496
2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 18859496) has the molecular formula C35H28F3N3O5S2 and a molecular weight of 691.75 g/mol. Its IUPAC name is 2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18859496 |
| Molecular Formula | C35H28F3N3O5S2 |
| Molecular Weight | 691.75 g/mol |
| Exact Mass | 691.14 |
| IUPAC Name | 2-[9-(4-methoxyphenyl)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccccc4C(F)(F)F)c3SC3C4CC(C5C(=O)N(c6ccccc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C35H28F3N3O5S2/c1-46-19-13-11-17(12-14-19)25-26-20-15-21(28-27(20)31(43)41(32(28)44)18-7-3-2-4-8-18)29(26)47-33-30(25)48-34(45)40(33)16-24(42)39-23-10-6-5-9-22(23)35(36,37)38/h2-14,20-21,25-29H,15-16H2,1H3,(H,39,42) |
| InChIKey | YKUHPKXKWUCFAX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.75 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|