C27H25N3O7S3 — CID 16558397
ethyl 4-[4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16558397) has the molecular formula C27H25N3O7S3 and a molecular weight of 599.71 g/mol. Its IUPAC name is ethyl 4-[4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16558397 |
| Molecular Formula | C27H25N3O7S3 |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | ethyl 4-[4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCOCC4)C(c4cccs4)C3C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O7S3/c1-2-37-26(34)15-5-7-16(8-6-15)30-23(32)20-19(17-4-3-13-38-17)22-25(39-21(20)24(30)33)29(27(35)40-22)14-18(31)28-9-11-36-12-10-28/h3-8,13,19-21H,2,9-12,14H2,1H3 |
| InChIKey | BXUYXAZJLHRUBL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|