C27H18F3N3O4S3 — CID 19249255
N-[2-(trifluoromethyl)phenyl]-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249255) has the molecular formula C27H18F3N3O4S3 and a molecular weight of 601.65 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249255 |
| Molecular Formula | C27H18F3N3O4S3 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.04 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccs1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]1S2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H18F3N3O4S3/c28-27(29,30)15-9-4-5-10-16(15)31-18(34)13-32-25-22(40-26(32)37)19(17-11-6-12-38-17)20-21(39-25)24(36)33(23(20)35)14-7-2-1-3-8-14/h1-12,19-21H,13H2,(H,31,34)/t19-,20-,21+/m0/s1 |
| InChIKey | IASHEIMJMULXNC-PCCBWWKXSA-N |
| XLogP | 5.42 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|