C29H19ClF3N3O4S2 — CID 43847182
2-[11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 43847182) has the molecular formula C29H19ClF3N3O4S2 and a molecular weight of 630.07 g/mol. Its IUPAC name is 2-[11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43847182 |
| Molecular Formula | C29H19ClF3N3O4S2 |
| Molecular Weight | 630.07 g/mol |
| Exact Mass | 629.05 |
| IUPAC Name | 2-[11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccccc1)C1C(=O)N(c3ccc(Cl)cc3)C(=O)C1S2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H19ClF3N3O4S2/c30-16-10-12-17(13-11-16)36-25(38)22-21(15-6-2-1-3-7-15)24-27(41-23(22)26(36)39)35(28(40)42-24)14-20(37)34-19-9-5-4-8-18(19)29(31,32)33/h1-13,21-23H,14H2,(H,34,37) |
| InChIKey | WVPZXJLBGIHBJM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|