C31H24ClF3N4O4S2 — CID 43847195
2-[11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 43847195) has the molecular formula C31H24ClF3N4O4S2 and a molecular weight of 673.14 g/mol. Its IUPAC name is 2-[11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43847195 |
| Molecular Formula | C31H24ClF3N4O4S2 |
| Molecular Weight | 673.14 g/mol |
| Exact Mass | 672.09 |
| IUPAC Name | 2-[11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(C)c1ccc(C2c3sc(=O)n(CC(=O)Nc4ccccc4C(F)(F)F)c3SC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C31H24ClF3N4O4S2/c1-37(2)18-11-7-16(8-12-18)23-24-25(28(42)39(27(24)41)19-13-9-17(32)10-14-19)44-29-26(23)45-30(43)38(29)15-22(40)36-21-6-4-3-5-20(21)31(33,34)35/h3-14,23-25H,15H2,1-2H3,(H,36,40) |
| InChIKey | JEHDMBOZJKAIMJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.14 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|