C24H20N4O7S3 — CID 43846540
ethyl 4-[[2-[(8R)-11-carbamoyl-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 43846540) has the molecular formula C24H20N4O7S3 and a molecular weight of 572.65 g/mol. Its IUPAC name is ethyl 4-[[2-[(8R)-11-carbamoyl-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(8R)-11-carbamoyl-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43846540 |
| Molecular Formula | C24H20N4O7S3 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | ethyl 4-[[2-[(8R)-11-carbamoyl-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccs2)C2C(=O)N(C(N)=O)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C24H20N4O7S3/c1-2-35-22(32)11-5-7-12(8-6-11)26-14(29)10-27-21-18(38-24(27)34)15(13-4-3-9-36-13)16-17(37-21)20(31)28(19(16)30)23(25)33/h3-9,15-17H,2,10H2,1H3,(H2,25,33)(H,26,29)/t15-,16?,17?/m0/s1 |
| InChIKey | HPXQCELEIOWQJS-GTPINHCMSA-N |
| XLogP | 2.46 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|