C32H27FN4O6S2 — CID 43846272
2-[(8R)-8-(4-tert-butylphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 43846272) has the molecular formula C32H27FN4O6S2 and a molecular weight of 646.72 g/mol. Its IUPAC name is 2-[(8R)-8-(4-tert-butylphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(8R)-8-(4-tert-butylphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 43846272 |
| Molecular Formula | C32H27FN4O6S2 |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | 2-[(8R)-8-(4-tert-butylphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(F)cc4)c3SC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C32H27FN4O6S2/c1-32(2,3)18-6-4-17(5-7-18)24-25-26(29(40)36(28(25)39)21-12-14-22(15-13-21)37(42)43)44-30-27(24)45-31(41)35(30)16-23(38)34-20-10-8-19(33)9-11-20/h4-15,24-26H,16H2,1-3H3,(H,34,38)/t24-,25?,26?/m0/s1 |
| InChIKey | ULLZSGHWBGRMKD-IHSPPPAMSA-N |
| XLogP | 5.69 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|