C28H16Cl4FN3O4S2 — CID 19249901
N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249901) has the molecular formula C28H16Cl4FN3O4S2 and a molecular weight of 683.40 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249901 |
| Molecular Formula | C28H16Cl4FN3O4S2 |
| Molecular Weight | 683.40 g/mol |
| Exact Mass | 680.93 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccc(Cl)c1Cl)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H16Cl4FN3O4S2/c29-16-9-6-13(10-18(16)31)34-19(37)11-35-27-24(42-28(35)40)20(15-2-1-3-17(30)22(15)32)21-23(41-27)26(39)36(25(21)38)14-7-4-12(33)5-8-14/h1-10,20-21,23H,11H2,(H,34,37)/t20-,21-,23+/m0/s1 |
| InChIKey | LEIZQNWCEVOCDU-QNWVGRARSA-N |
| XLogP | 7.10 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|