C32H20BrCl2N3O4S2 — CID 16634782
2-[(8S)-11-(4-bromophenyl)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 16634782) has the molecular formula C32H20BrCl2N3O4S2 and a molecular weight of 725.47 g/mol. Its IUPAC name is 2-[(8S)-11-(4-bromophenyl)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(8S)-11-(4-bromophenyl)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16634782 |
| Molecular Formula | C32H20BrCl2N3O4S2 |
| Molecular Weight | 725.47 g/mol |
| Exact Mass | 722.95 |
| IUPAC Name | 2-[(8S)-11-(4-bromophenyl)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccc(Cl)c1Cl)C1C(=O)N(c3ccc(Br)cc3)C(=O)C1S2)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H20BrCl2N3O4S2/c33-18-9-12-20(13-10-18)38-29(40)25-24(21-6-3-7-22(34)26(21)35)28-31(43-27(25)30(38)41)37(32(42)44-28)15-23(39)36-19-11-8-16-4-1-2-5-17(16)14-19/h1-14,24-25,27H,15H2,(H,36,39)/t24-,25?,27?/m1/s1 |
| InChIKey | LIFPCPVWIVHVRO-VTRCLXOYSA-N |
| XLogP | 7.57 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.47 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|