C35H32BrN3O6S2 — CID 18862214
ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862214) has the molecular formula C35H32BrN3O6S2 and a molecular weight of 734.69 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862214 |
| Molecular Formula | C35H32BrN3O6S2 |
| Molecular Weight | 734.69 g/mol |
| Exact Mass | 733.09 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(C(C)(C)C)cc2)[C@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C35H32BrN3O6S2/c1-5-45-33(43)20-8-14-23(15-9-20)37-25(40)18-38-32-29(47-34(38)44)26(19-6-10-21(11-7-19)35(2,3)4)27-28(46-32)31(42)39(30(27)41)24-16-12-22(36)13-17-24/h6-17,26-28H,5,18H2,1-4H3,(H,37,40)/t26-,27+,28-/m0/s1 |
| InChIKey | RGJJMUVLBPOHDY-IARZGTGTSA-N |
| XLogP | 6.58 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|