C24H20N4O8S2 — CID 43847552
8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-(4-nitrophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43847552) has the molecular formula C24H20N4O8S2 and a molecular weight of 556.58 g/mol. Its IUPAC name is 8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-(4-nitrophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-(4-nitrophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43847552 |
| Molecular Formula | C24H20N4O8S2 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-(4-nitrophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccco1)C1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C1S2)N1CCOCC1 |
| InChI | InChI=1S/C24H20N4O8S2/c29-16(25-7-10-35-11-8-25)12-26-23-20(38-24(26)32)17(15-2-1-9-36-15)18-19(37-23)22(31)27(21(18)30)13-3-5-14(6-4-13)28(33)34/h1-6,9,17-19H,7-8,10-12H2 |
| InChIKey | DYNSPEJTQGDJLC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 145.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|