C29H18Cl2F3N3O5S2 — CID 19248731
2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 19248731) has the molecular formula C29H18Cl2F3N3O5S2 and a molecular weight of 680.51 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19248731 |
| Molecular Formula | C29H18Cl2F3N3O5S2 |
| Molecular Weight | 680.51 g/mol |
| Exact Mass | 679.00 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccc(Cl)c1Cl)[C@@H]1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]1S2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C29H18Cl2F3N3O5S2/c30-18-6-2-5-17(22(18)31)20-21-23(26(41)37(25(21)40)15-4-1-3-13(11-15)29(32,33)34)43-27-24(20)44-28(42)36(27)12-19(39)35-14-7-9-16(38)10-8-14/h1-11,20-21,23,38H,12H2,(H,35,39)/t20-,21-,23+/m0/s1 |
| InChIKey | QEUZIRUGBCNAQE-QNWVGRARSA-N |
| XLogP | 6.38 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|