C26H23FN2O7S2 — CID 19249849
ethyl 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 19249849) has the molecular formula C26H23FN2O7S2 and a molecular weight of 558.61 g/mol. Its IUPAC name is ethyl 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 19249849 |
| Molecular Formula | C26H23FN2O7S2 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | ethyl 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1ccc(OC)c(OC)c1)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C26H23FN2O7S2/c1-4-36-18(30)12-28-25-22(38-26(28)33)19(13-5-10-16(34-2)17(11-13)35-3)20-21(37-25)24(32)29(23(20)31)15-8-6-14(27)7-9-15/h5-11,19-21H,4,12H2,1-3H3/t19-,20-,21+/m0/s1 |
| InChIKey | MVGQOKQYKPZVBQ-PCCBWWKXSA-N |
| XLogP | 3.42 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|